C15H18O3 — CID 10824327
(1S,3R,6S,10S,11R)-3-methyl-7,12-dimethylidene-2,9-dioxatetracyclo[9.3.0.01,3.06,10]tetradecan-8-one (PubChem CID 10824327) has the molecular formula C15H18O3 and a molecular weight of 246.31 g/mol. Its IUPAC name is (1S,3R,6S,10S,11R)-3-methyl-7,12-dimethylidene-2,9-dioxatetracyclo[9.3.0.01,3.06,10]tetradecan-8-one.
| Compound Name | (1S,3R,6S,10S,11R)-3-methyl-7,12-dimethylidene-2,9-dioxatetracyclo[9.3.0.01,3.06,10]tetradecan-8-one |
|---|---|
| PubChem CID | 10824327 |
| Molecular Formula | C15H18O3 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | (1S,3R,6S,10S,11R)-3-methyl-7,12-dimethylidene-2,9-dioxatetracyclo[9.3.0.01,3.06,10]tetradecan-8-one |
| SMILES | C=C1CC[C@@]23O[C@]2(C)CC[C@H]2C(=C)C(=O)O[C@@H]2[C@@H]13 |
| InChI | InChI=1S/C15H18O3/c1-8-4-7-15-11(8)12-10(9(2)13(16)17-12)5-6-14(15,3)18-15/h10-12H,1-2,4-7H2,3H3/t10-,11+,12-,14+,15-/m0/s1 |
| InChIKey | MTTHCEUZUAEDTP-OEMOEHNSSA-N |
| XLogP | 2.37 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|