C15H21NS — CID 10824407
(1S)-2-[(3aR,6aR)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-1-yl]-1-phenylethanethiol (PubChem CID 10824407) has the molecular formula C15H21NS and a molecular weight of 247.41 g/mol. Its IUPAC name is (1S)-2-[(3aR,6aR)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-1-yl]-1-phenylethanethiol.
| Compound Name | (1S)-2-[(3aR,6aR)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-1-yl]-1-phenylethanethiol |
|---|---|
| PubChem CID | 10824407 |
| Molecular Formula | C15H21NS |
| Molecular Weight | 247.41 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | (1S)-2-[(3aR,6aR)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-1-yl]-1-phenylethanethiol |
| SMILES | S[C@H](CN1CC[C@H]2CCC[C@H]21)c1ccccc1 |
| InChI | InChI=1S/C15H21NS/c17-15(13-5-2-1-3-6-13)11-16-10-9-12-7-4-8-14(12)16/h1-3,5-6,12,14-15,17H,4,7-11H2/t12-,14-,15-/m1/s1 |
| InChIKey | HLKDUGNJYOJPMO-BPLDGKMQSA-N |
| XLogP | 3.53 |
| TPSA | 3.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.41 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|