C13H15NO2S — CID 10824521
(1S,2S,4S,7S)-1-(benzenesulfonyl)-3-azatricyclo[5.1.0.02,4]octane (PubChem CID 10824521) has the molecular formula C13H15NO2S and a molecular weight of 249.33 g/mol. Its IUPAC name is (1S,2S,4S,7S)-1-(benzenesulfonyl)-3-azatricyclo[5.1.0.02,4]octane.
| Compound Name | (1S,2S,4S,7S)-1-(benzenesulfonyl)-3-azatricyclo[5.1.0.02,4]octane |
|---|---|
| PubChem CID | 10824521 |
| Molecular Formula | C13H15NO2S |
| Molecular Weight | 249.33 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | (1S,2S,4S,7S)-1-(benzenesulfonyl)-3-azatricyclo[5.1.0.02,4]octane |
| SMILES | O=S(=O)(c1ccccc1)[C@@]12C[C@@H]1CC[C@@H]1N[C@@H]12 |
| InChI | InChI=1S/C13H15NO2S/c15-17(16,10-4-2-1-3-5-10)13-8-9(13)6-7-11-12(13)14-11/h1-5,9,11-12,14H,6-8H2/t9-,11-,12-,13-/m0/s1 |
| InChIKey | DSOROHIQXCDQDO-BQUFFADESA-N |
| XLogP | 1.35 |
| TPSA | 56.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.33 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|