C16H30O2 — CID 10824861
(2S,4S,6S)-4-hexyl-2-propan-2-yl-6-prop-2-enyl-1,3-dioxane (PubChem CID 10824861) has the molecular formula C16H30O2 and a molecular weight of 254.41 g/mol. Its IUPAC name is (2S,4S,6S)-4-hexyl-2-propan-2-yl-6-prop-2-enyl-1,3-dioxane.
| Compound Name | (2S,4S,6S)-4-hexyl-2-propan-2-yl-6-prop-2-enyl-1,3-dioxane |
|---|---|
| PubChem CID | 10824861 |
| Molecular Formula | C16H30O2 |
| Molecular Weight | 254.41 g/mol |
| Exact Mass | 254.22 |
| IUPAC Name | (2S,4S,6S)-4-hexyl-2-propan-2-yl-6-prop-2-enyl-1,3-dioxane |
| SMILES | C=CC[C@H]1C[C@H](CCCCCC)O[C@H](C(C)C)O1 |
| InChI | InChI=1S/C16H30O2/c1-5-7-8-9-11-15-12-14(10-6-2)17-16(18-15)13(3)4/h6,13-16H,2,5,7-12H2,1,3-4H3/t14-,15-,16+/m0/s1 |
| InChIKey | SEZONOUIRXPIDY-HRCADAONSA-N |
| XLogP | 4.69 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.41 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|