C14H26O2Si — CID 10824865
cis-ethyl (1S,2S)-2-[(E)-2-trimethylsilylethenyl]cyclohexane-1-carboxylate (PubChem CID 10824865) has the molecular formula C14H26O2Si and a molecular weight of 254.45 g/mol. Its IUPAC name is cis-ethyl (1S,2S)-2-[(E)-2-trimethylsilylethenyl]cyclohexane-1-carboxylate.
| Compound Name | cis-ethyl (1S,2S)-2-[(E)-2-trimethylsilylethenyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 10824865 |
| Molecular Formula | C14H26O2Si |
| Molecular Weight | 254.45 g/mol |
| Exact Mass | 254.17 |
| IUPAC Name | cis-ethyl (1S,2S)-2-[(E)-2-trimethylsilylethenyl]cyclohexane-1-carboxylate |
| SMILES | CCOC(=O)[C@H]1CCCC[C@@H]1/C=C/[Si](C)(C)C |
| InChI | InChI=1S/C14H26O2Si/c1-5-16-14(15)13-9-7-6-8-12(13)10-11-17(2,3)4/h10-13H,5-9H2,1-4H3/b11-10+/t12-,13+/m1/s1 |
| InChIKey | USPIXQRONWDQFT-NQYVGZPUSA-N |
| XLogP | 3.79 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.45 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|