C16H34Si — CID 10824870
triethyl-[(E)-2,3,5,5-tetramethylhex-2-enyl]silane (PubChem CID 10824870) has the molecular formula C16H34Si and a molecular weight of 254.53 g/mol. Its IUPAC name is triethyl-[(E)-2,3,5,5-tetramethylhex-2-enyl]silane.
| Compound Name | triethyl-[(E)-2,3,5,5-tetramethylhex-2-enyl]silane |
|---|---|
| PubChem CID | 10824870 |
| Molecular Formula | C16H34Si |
| Molecular Weight | 254.53 g/mol |
| Exact Mass | 254.24 |
| IUPAC Name | triethyl-[(E)-2,3,5,5-tetramethylhex-2-enyl]silane |
| SMILES | CC[Si](CC)(CC)C/C(C)=C(\C)CC(C)(C)C |
| InChI | InChI=1S/C16H34Si/c1-9-17(10-2,11-3)13-15(5)14(4)12-16(6,7)8/h9-13H2,1-8H3/b15-14+ |
| InChIKey | MJAALSLATNFHLT-CCEZHUSRSA-N |
| XLogP | 6.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.53 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|