C9H13N5O2S — CID 10824907
1,6-diethyl-2,2-dioxopyrazino[2,3-c][1,2,6]thiadiazin-4-amine (PubChem CID 10824907) has the molecular formula C9H13N5O2S and a molecular weight of 255.30 g/mol. Its IUPAC name is 1,6-diethyl-2,2-dioxopyrazino[2,3-c][1,2,6]thiadiazin-4-amine.
| Compound Name | 1,6-diethyl-2,2-dioxopyrazino[2,3-c][1,2,6]thiadiazin-4-amine |
|---|---|
| PubChem CID | 10824907 |
| Molecular Formula | C9H13N5O2S |
| Molecular Weight | 255.30 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | 1,6-diethyl-2,2-dioxopyrazino[2,3-c][1,2,6]thiadiazin-4-amine |
| SMILES | CCc1cnc2c(n1)C(N)=NS(=O)(=O)N2CC |
| InChI | InChI=1S/C9H13N5O2S/c1-3-6-5-11-9-7(12-6)8(10)13-17(15,16)14(9)4-2/h5H,3-4H2,1-2H3,(H2,10,13) |
| InChIKey | JMXYFTIMCXGZAI-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 101.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.30 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |