C15H15NO3 — CID 10825031
(1S,2R,6R,9S)-9-phenyl-7,11-dioxa-8-azatricyclo[6.4.0.02,6]dodec-4-en-12-one (PubChem CID 10825031) has the molecular formula C15H15NO3 and a molecular weight of 257.29 g/mol. Its IUPAC name is (1S,2R,6R,9S)-9-phenyl-7,11-dioxa-8-azatricyclo[6.4.0.02,6]dodec-4-en-12-one.
| Compound Name | (1S,2R,6R,9S)-9-phenyl-7,11-dioxa-8-azatricyclo[6.4.0.02,6]dodec-4-en-12-one |
|---|---|
| PubChem CID | 10825031 |
| Molecular Formula | C15H15NO3 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | (1S,2R,6R,9S)-9-phenyl-7,11-dioxa-8-azatricyclo[6.4.0.02,6]dodec-4-en-12-one |
| SMILES | O=C1OC[C@H](c2ccccc2)N2O[C@@H]3C=CC[C@@H]3[C@@H]12 |
| InChI | InChI=1S/C15H15NO3/c17-15-14-11-7-4-8-13(11)19-16(14)12(9-18-15)10-5-2-1-3-6-10/h1-6,8,11-14H,7,9H2/t11-,12+,13+,14-/m0/s1 |
| InChIKey | AOQQXCZRYGXXNE-DGAVXFQQSA-N |
| XLogP | 1.85 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|