C12H19ClO4 — CID 10825409
(5R)-5-[[(4S,6R)-6-(chloromethyl)-2,2-dimethyl-1,3-dioxan-4-yl]methyl]oxolan-2-one (PubChem CID 10825409) has the molecular formula C12H19ClO4 and a molecular weight of 262.73 g/mol. Its IUPAC name is (5R)-5-[[(4S,6R)-6-(chloromethyl)-2,2-dimethyl-1,3-dioxan-4-yl]methyl]oxolan-2-one.
| Compound Name | (5R)-5-[[(4S,6R)-6-(chloromethyl)-2,2-dimethyl-1,3-dioxan-4-yl]methyl]oxolan-2-one |
|---|---|
| PubChem CID | 10825409 |
| Molecular Formula | C12H19ClO4 |
| Molecular Weight | 262.73 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | (5R)-5-[[(4S,6R)-6-(chloromethyl)-2,2-dimethyl-1,3-dioxan-4-yl]methyl]oxolan-2-one |
| SMILES | CC1(C)O[C@@H](CCl)C[C@H](C[C@H]2CCC(=O)O2)O1 |
| InChI | InChI=1S/C12H19ClO4/c1-12(2)16-9(6-10(7-13)17-12)5-8-3-4-11(14)15-8/h8-10H,3-7H2,1-2H3/t8-,9+,10-/m1/s1 |
| InChIKey | JKXPKWOXMBIJLN-KXUCPTDWSA-N |
| XLogP | 2.23 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.73 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|