About triethyl(hexyl)azanium bromide
triethyl(hexyl)azanium bromide (PubChem CID 10825627) has the molecular formula C12H28BrN
and a molecular weight of 266.27 g/mol. Its IUPAC name is triethyl(hexyl)azanium bromide.
Molecular Properties
| Compound Name | triethyl(hexyl)azanium bromide |
| PubChem CID | 10825627 |
| Molecular Formula | C12H28BrN |
| Molecular Weight | 266.27 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | triethyl(hexyl)azanium bromide |
| SMILES | CCCCCC[N+](CC)(CC)CC.[Br-] |
| InChI | InChI=1S/C12H28N.BrH/c1-5-9-10-11-12-13(6-2,7-3)8-4;/h5-12H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | NAWZSHBMUXXTGV-UHFFFAOYSA-M |
| XLogP | 0.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.27 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze triethyl(hexyl)azanium bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triethyl(hexyl)azanium bromide?
The IUPAC name of triethyl(hexyl)azanium bromide (CID 10825627) is triethyl(hexyl)azanium bromide.
What is the SMILES notation for triethyl(hexyl)azanium bromide?
The canonical SMILES for triethyl(hexyl)azanium bromide is CCCCCC[N+](CC)(CC)CC.[Br-].
What is the InChIKey of triethyl(hexyl)azanium bromide?
The InChIKey is NAWZSHBMUXXTGV-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H28N.BrH/c1-5-9-10-11-12-13(6-2,7-3)8-4;/h5-12H2,1-4H3;1H/q+1;/p-1.
What are the key properties of triethyl(hexyl)azanium bromide?
triethyl(hexyl)azanium bromide has a molecular weight of 266.27 g/mol, XLogP of 0.45, 8 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for triethyl(hexyl)azanium bromide is sourced from PubChem (CID 10825627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).