C18H18O2 — CID 10825653
(1aS,7bS)-6-benzyl-2,2-dimethyl-1a,7b-dihydrooxireno[2,3-c]chromene (PubChem CID 10825653) has the molecular formula C18H18O2 and a molecular weight of 266.34 g/mol. Its IUPAC name is (1aS,7bS)-6-benzyl-2,2-dimethyl-1a,7b-dihydrooxireno[2,3-c]chromene.
| Compound Name | (1aS,7bS)-6-benzyl-2,2-dimethyl-1a,7b-dihydrooxireno[2,3-c]chromene |
|---|---|
| PubChem CID | 10825653 |
| Molecular Formula | C18H18O2 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | (1aS,7bS)-6-benzyl-2,2-dimethyl-1a,7b-dihydrooxireno[2,3-c]chromene |
| SMILES | CC1(C)Oc2ccc(Cc3ccccc3)cc2[C@@H]2O[C@@H]21 |
| InChI | InChI=1S/C18H18O2/c1-18(2)17-16(19-17)14-11-13(8-9-15(14)20-18)10-12-6-4-3-5-7-12/h3-9,11,16-17H,10H2,1-2H3/t16-,17-/m0/s1 |
| InChIKey | NCOGTVZCMIGHKD-IRXDYDNUSA-N |
| XLogP | 3.89 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|