C16H15NO3 — CID 10825839
(3S,4S)-2-benzyl-4-hydroxy-3-phenyl-1,2-oxazolidin-5-one (PubChem CID 10825839) has the molecular formula C16H15NO3 and a molecular weight of 269.30 g/mol. Its IUPAC name is (3S,4S)-2-benzyl-4-hydroxy-3-phenyl-1,2-oxazolidin-5-one.
| Compound Name | (3S,4S)-2-benzyl-4-hydroxy-3-phenyl-1,2-oxazolidin-5-one |
|---|---|
| PubChem CID | 10825839 |
| Molecular Formula | C16H15NO3 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | (3S,4S)-2-benzyl-4-hydroxy-3-phenyl-1,2-oxazolidin-5-one |
| SMILES | O=C1ON(Cc2ccccc2)[C@@H](c2ccccc2)[C@@H]1O |
| InChI | InChI=1S/C16H15NO3/c18-15-14(13-9-5-2-6-10-13)17(20-16(15)19)11-12-7-3-1-4-8-12/h1-10,14-15,18H,11H2/t14-,15-/m0/s1 |
| InChIKey | UAEZICAWNWVCQI-GJZGRUSLSA-N |
| XLogP | 2.06 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |