C16H15NOS — CID 10825862
6,8,9,10,11,12-hexahydrothiochromeno[3,4-c]quinolin-7-one (PubChem CID 10825862) has the molecular formula C16H15NOS and a molecular weight of 269.37 g/mol. Its IUPAC name is 6,8,9,10,11,12-hexahydrothiochromeno[3,4-c]quinolin-7-one.
| Compound Name | 6,8,9,10,11,12-hexahydrothiochromeno[3,4-c]quinolin-7-one |
|---|---|
| PubChem CID | 10825862 |
| Molecular Formula | C16H15NOS |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | 6,8,9,10,11,12-hexahydrothiochromeno[3,4-c]quinolin-7-one |
| SMILES | O=c1[nH]c2c(c3c1CSc1ccccc1-3)CCCC2 |
| InChI | InChI=1S/C16H15NOS/c18-16-12-9-19-14-8-4-2-6-11(14)15(12)10-5-1-3-7-13(10)17-16/h2,4,6,8H,1,3,5,7,9H2,(H,17,18) |
| InChIKey | NFKOOKRKTOXGNE-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |