C15H27NO3 — CID 10825864
ethyl (4aR,6S,8aS)-6-hydroxy-5,5,8a-trimethyl-3,4,4a,6,7,8-hexahydro-1H-isoquinoline-2-carboxylate (PubChem CID 10825864) has the molecular formula C15H27NO3 and a molecular weight of 269.38 g/mol. Its IUPAC name is ethyl (4aR,6S,8aS)-6-hydroxy-5,5,8a-trimethyl-3,4,4a,6,7,8-hexahydro-1H-isoquinoline-2-carboxylate.
| Compound Name | ethyl (4aR,6S,8aS)-6-hydroxy-5,5,8a-trimethyl-3,4,4a,6,7,8-hexahydro-1H-isoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 10825864 |
| Molecular Formula | C15H27NO3 |
| Molecular Weight | 269.38 g/mol |
| Exact Mass | 269.20 |
| IUPAC Name | ethyl (4aR,6S,8aS)-6-hydroxy-5,5,8a-trimethyl-3,4,4a,6,7,8-hexahydro-1H-isoquinoline-2-carboxylate |
| SMILES | CCOC(=O)N1CC[C@H]2C(C)(C)[C@@H](O)CC[C@]2(C)C1 |
| InChI | InChI=1S/C15H27NO3/c1-5-19-13(18)16-9-7-11-14(2,3)12(17)6-8-15(11,4)10-16/h11-12,17H,5-10H2,1-4H3/t11-,12-,15+/m0/s1 |
| InChIKey | BLBXOMGETAMBQV-SLEUVZQESA-N |
| XLogP | 2.65 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.38 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |