C15H17NO4 — CID 10826240
benzyl N-[(1S)-1-[(2S)-4-methylidene-5-oxooxolan-2-yl]ethyl]carbamate (PubChem CID 10826240) has the molecular formula C15H17NO4 and a molecular weight of 275.30 g/mol. Its IUPAC name is benzyl N-[(1S)-1-[(2S)-4-methylidene-5-oxooxolan-2-yl]ethyl]carbamate.
| Compound Name | benzyl N-[(1S)-1-[(2S)-4-methylidene-5-oxooxolan-2-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 10826240 |
| Molecular Formula | C15H17NO4 |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | benzyl N-[(1S)-1-[(2S)-4-methylidene-5-oxooxolan-2-yl]ethyl]carbamate |
| SMILES | C=C1C[C@@H]([C@H](C)NC(=O)OCc2ccccc2)OC1=O |
| InChI | InChI=1S/C15H17NO4/c1-10-8-13(20-14(10)17)11(2)16-15(18)19-9-12-6-4-3-5-7-12/h3-7,11,13H,1,8-9H2,2H3,(H,16,18)/t11-,13-/m0/s1 |
| InChIKey | LCYSXYVOAOPUDG-AAEUAGOBSA-N |
| XLogP | 2.17 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|