C19H22N2 — CID 10826477
(1R,13R)-15-propan-2-yl-10-azatetracyclo[11.3.1.02,11.04,9]heptadeca-2,4,6,8,10,14-hexaen-3-amine (PubChem CID 10826477) has the molecular formula C19H22N2 and a molecular weight of 278.40 g/mol. Its IUPAC name is (1R,13R)-15-propan-2-yl-10-azatetracyclo[11.3.1.02,11.04,9]heptadeca-2,4,6,8,10,14-hexaen-3-amine.
| Compound Name | (1R,13R)-15-propan-2-yl-10-azatetracyclo[11.3.1.02,11.04,9]heptadeca-2,4,6,8,10,14-hexaen-3-amine |
|---|---|
| PubChem CID | 10826477 |
| Molecular Formula | C19H22N2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | (1R,13R)-15-propan-2-yl-10-azatetracyclo[11.3.1.02,11.04,9]heptadeca-2,4,6,8,10,14-hexaen-3-amine |
| SMILES | CC(C)C1=C[C@H]2Cc3nc4ccccc4c(N)c3[C@@H](C1)C2 |
| InChI | InChI=1S/C19H22N2/c1-11(2)13-7-12-8-14(10-13)18-17(9-12)21-16-6-4-3-5-15(16)19(18)20/h3-7,11-12,14H,8-10H2,1-2H3,(H2,20,21)/t12-,14-/m1/s1 |
| InChIKey | VBKFLODLBRKVOX-TZMCWYRMSA-N |
| XLogP | 4.45 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|