C15H14N4O2 — CID 10826741
2-(4-methoxyphenyl)-3,6,10,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(12),8,10-trien-7-one (PubChem CID 10826741) has the molecular formula C15H14N4O2 and a molecular weight of 282.30 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-3,6,10,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(12),8,10-trien-7-one.
| Compound Name | 2-(4-methoxyphenyl)-3,6,10,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(12),8,10-trien-7-one |
|---|---|
| PubChem CID | 10826741 |
| Molecular Formula | C15H14N4O2 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | 2-(4-methoxyphenyl)-3,6,10,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(12),8,10-trien-7-one |
| SMILES | COc1ccc(C23NCCN2C(=O)c2cnncc23)cc1 |
| InChI | InChI=1S/C15H14N4O2/c1-21-11-4-2-10(3-5-11)15-13-9-18-17-8-12(13)14(20)19(15)7-6-16-15/h2-5,8-9,16H,6-7H2,1H3 |
| InChIKey | UVXKVXSKJXVASV-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |