C19H26N2 — CID 10826786
N-tert-butyl-1-spiro[2,3-dihydro-1H-naphthalene-4,6'-2,5-dihydropyridine]-1'-ylmethanimine (PubChem CID 10826786) has the molecular formula C19H26N2 and a molecular weight of 282.43 g/mol. Its IUPAC name is N-tert-butyl-1-spiro[2,3-dihydro-1H-naphthalene-4,6'-2,5-dihydropyridine]-1'-ylmethanimine.
| Compound Name | N-tert-butyl-1-spiro[2,3-dihydro-1H-naphthalene-4,6'-2,5-dihydropyridine]-1'-ylmethanimine |
|---|---|
| PubChem CID | 10826786 |
| Molecular Formula | C19H26N2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | N-tert-butyl-1-spiro[2,3-dihydro-1H-naphthalene-4,6'-2,5-dihydropyridine]-1'-ylmethanimine |
| SMILES | CC(C)(C)/N=C/N1CC=CCC12CCCc1ccccc12 |
| InChI | InChI=1S/C19H26N2/c1-18(2,3)20-15-21-14-7-6-12-19(21)13-8-10-16-9-4-5-11-17(16)19/h4-7,9,11,15H,8,10,12-14H2,1-3H3/b20-15+ |
| InChIKey | LOUNHNILPJIRBK-HMMYKYKNSA-N |
| XLogP | 4.31 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|