About 2-methyl-1-nitro-4-[(4,6,6-trimethyl-2-methylidenecyclohex-3-en-1-yl)methyl]benzene
2-methyl-1-nitro-4-[(4,6,6-trimethyl-2-methylidenecyclohex-3-en-1-yl)methyl]benzene (PubChem CID 10827013) has the molecular formula C18H23NO2
and a molecular weight of 285.39 g/mol. Its IUPAC name is 2-methyl-1-nitro-4-[(4,6,6-trimethyl-2-methylidenecyclohex-3-en-1-yl)methyl]benzene.
Molecular Properties
| Compound Name | 2-methyl-1-nitro-4-[(4,6,6-trimethyl-2-methylidenecyclohex-3-en-1-yl)methyl]benzene |
| PubChem CID | 10827013 |
| Molecular Formula | C18H23NO2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | 2-methyl-1-nitro-4-[(4,6,6-trimethyl-2-methylidenecyclohex-3-en-1-yl)methyl]benzene |
| SMILES | C=C1C=C(C)CC(C)(C)C1Cc1ccc([N+](=O)[O-])c(C)c1 |
| InChI | InChI=1S/C18H23NO2/c1-12-8-13(2)16(18(4,5)11-12)10-15-6-7-17(19(20)21)14(3)9-15/h6-9,16H,2,10-11H2,1,3-5H3 |
| InChIKey | ARDKBOYBRBHJCL-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-1-nitro-4-[(4,6,6-trimethyl-2-methylidenecyclohex-3-en-1-yl)methyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1-nitro-4-[(4,6,6-trimethyl-2-methylidenecyclohex-3-en-1-yl)methyl]benzene?
The IUPAC name of 2-methyl-1-nitro-4-[(4,6,6-trimethyl-2-methylidenecyclohex-3-en-1-yl)methyl]benzene (CID 10827013) is 2-methyl-1-nitro-4-[(4,6,6-trimethyl-2-methylidenecyclohex-3-en-1-yl)methyl]benzene.
What is the SMILES notation for 2-methyl-1-nitro-4-[(4,6,6-trimethyl-2-methylidenecyclohex-3-en-1-yl)methyl]benzene?
The canonical SMILES for 2-methyl-1-nitro-4-[(4,6,6-trimethyl-2-methylidenecyclohex-3-en-1-yl)methyl]benzene is C=C1C=C(C)CC(C)(C)C1Cc1ccc([N+](=O)[O-])c(C)c1.
What is the InChIKey of 2-methyl-1-nitro-4-[(4,6,6-trimethyl-2-methylidenecyclohex-3-en-1-yl)methyl]benzene?
The InChIKey is ARDKBOYBRBHJCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23NO2/c1-12-8-13(2)16(18(4,5)11-12)10-15-6-7-17(19(20)21)14(3)9-15/h6-9,16H,2,10-11H2,1,3-5H3.
What are the key properties of 2-methyl-1-nitro-4-[(4,6,6-trimethyl-2-methylidenecyclohex-3-en-1-yl)methyl]benzene?
2-methyl-1-nitro-4-[(4,6,6-trimethyl-2-methylidenecyclohex-3-en-1-yl)methyl]benzene has a molecular weight of 285.39 g/mol, XLogP of 4.99, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1-nitro-4-[(4,6,6-trimethyl-2-methylidenecyclohex-3-en-1-yl)methyl]benzene is sourced from PubChem (CID 10827013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).