C13H16ClNO4 — CID 10827030
(2R,3R)-2-amino-3-(4-chlorophenyl)-5-ethoxy-5-oxopentanoic acid (PubChem CID 10827030) has the molecular formula C13H16ClNO4 and a molecular weight of 285.73 g/mol. Its IUPAC name is (2R,3R)-2-amino-3-(4-chlorophenyl)-5-ethoxy-5-oxopentanoic acid.
| Compound Name | (2R,3R)-2-amino-3-(4-chlorophenyl)-5-ethoxy-5-oxopentanoic acid |
|---|---|
| PubChem CID | 10827030 |
| Molecular Formula | C13H16ClNO4 |
| Molecular Weight | 285.73 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | (2R,3R)-2-amino-3-(4-chlorophenyl)-5-ethoxy-5-oxopentanoic acid |
| SMILES | CCOC(=O)C[C@H](c1ccc(Cl)cc1)[C@@H](N)C(=O)O |
| InChI | InChI=1S/C13H16ClNO4/c1-2-19-11(16)7-10(12(15)13(17)18)8-3-5-9(14)6-4-8/h3-6,10,12H,2,7,15H2,1H3,(H,17,18)/t10-,12-/m1/s1 |
| InChIKey | WHWXXJHWRQVZNB-ZYHUDNBSSA-N |
| XLogP | 1.79 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.73 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |