About 1,3-dipyridin-4-ylurea
1,3-dipyridin-4-ylurea (PubChem CID 1082704) has the molecular formula C11H10N4O
and a molecular weight of 214.23 g/mol. Its IUPAC name is 1,3-dipyridin-4-ylurea.
Molecular Properties
| Compound Name | 1,3-dipyridin-4-ylurea |
| PubChem CID | 1082704 |
| Molecular Formula | C11H10N4O |
| Molecular Weight | 214.23 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | 1,3-dipyridin-4-ylurea |
| SMILES | O=C(Nc1ccncc1)Nc1ccncc1 |
| InChI | InChI=1S/C11H10N4O/c16-11(14-9-1-5-12-6-2-9)15-10-3-7-13-8-4-10/h1-8H,(H2,12,13,14,15,16) |
| InChIKey | QRRGJASIECDXQW-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.23 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,3-dipyridin-4-ylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dipyridin-4-ylurea?
The IUPAC name of 1,3-dipyridin-4-ylurea (CID 1082704) is 1,3-dipyridin-4-ylurea.
What is the SMILES notation for 1,3-dipyridin-4-ylurea?
The canonical SMILES for 1,3-dipyridin-4-ylurea is O=C(Nc1ccncc1)Nc1ccncc1.
What is the InChIKey of 1,3-dipyridin-4-ylurea?
The InChIKey is QRRGJASIECDXQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N4O/c16-11(14-9-1-5-12-6-2-9)15-10-3-7-13-8-4-10/h1-8H,(H2,12,13,14,15,16).
What are the key properties of 1,3-dipyridin-4-ylurea?
1,3-dipyridin-4-ylurea has a molecular weight of 214.23 g/mol, XLogP of 2.12, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dipyridin-4-ylurea is sourced from PubChem (CID 1082704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).