C17H18N2OS2 — CID 1082719
(4-ethylpiperazin-1-yl)-thieno[3,2-b][1]benzothiol-2-ylmethanone (PubChem CID 1082719) has the molecular formula C17H18N2OS2 and a molecular weight of 330.48 g/mol. Its IUPAC name is (4-ethylpiperazin-1-yl)-thieno[3,2-b][1]benzothiol-2-ylmethanone.
| Compound Name | (4-ethylpiperazin-1-yl)-thieno[3,2-b][1]benzothiol-2-ylmethanone |
|---|---|
| PubChem CID | 1082719 |
| Molecular Formula | C17H18N2OS2 |
| Molecular Weight | 330.48 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | (4-ethylpiperazin-1-yl)-thieno[3,2-b][1]benzothiol-2-ylmethanone |
| SMILES | CCN1CCN(C(=O)c2cc3sc4ccccc4c3s2)CC1 |
| InChI | InChI=1S/C17H18N2OS2/c1-2-18-7-9-19(10-8-18)17(20)15-11-14-16(22-15)12-5-3-4-6-13(12)21-14/h3-6,11H,2,7-10H2,1H3 |
| InChIKey | YBQUGENMPYANPG-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.48 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |