C16H20N2O3 — CID 10827210
1-hydroxy-1-[1-[5-(2,4,6-trimethylphenyl)furan-2-yl]ethyl]urea (PubChem CID 10827210) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is 1-hydroxy-1-[1-[5-(2,4,6-trimethylphenyl)furan-2-yl]ethyl]urea.
| Compound Name | 1-hydroxy-1-[1-[5-(2,4,6-trimethylphenyl)furan-2-yl]ethyl]urea |
|---|---|
| PubChem CID | 10827210 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | 1-hydroxy-1-[1-[5-(2,4,6-trimethylphenyl)furan-2-yl]ethyl]urea |
| SMILES | Cc1cc(C)c(-c2ccc(C(C)N(O)C(N)=O)o2)c(C)c1 |
| InChI | InChI=1S/C16H20N2O3/c1-9-7-10(2)15(11(3)8-9)14-6-5-13(21-14)12(4)18(20)16(17)19/h5-8,12,20H,1-4H3,(H2,17,19) |
| InChIKey | UEARNVPQMVHGLQ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 79.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|