About 5-ethyl-2-[(3,4,5-trimethoxybenzoyl)amino]thiophene-3-carboxylic acid
5-ethyl-2-[(3,4,5-trimethoxybenzoyl)amino]thiophene-3-carboxylic acid (PubChem CID 1082731) has the molecular formula C17H19NO6S
and a molecular weight of 365.41 g/mol. Its IUPAC name is 5-ethyl-2-[(3,4,5-trimethoxybenzoyl)amino]thiophene-3-carboxylic acid.
Molecular Properties
| Compound Name | 5-ethyl-2-[(3,4,5-trimethoxybenzoyl)amino]thiophene-3-carboxylic acid |
| PubChem CID | 1082731 |
| Molecular Formula | C17H19NO6S |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | 5-ethyl-2-[(3,4,5-trimethoxybenzoyl)amino]thiophene-3-carboxylic acid |
| SMILES | CCc1cc(C(=O)O)c(NC(=O)c2cc(OC)c(OC)c(OC)c2)s1 |
| InChI | InChI=1S/C17H19NO6S/c1-5-10-8-11(17(20)21)16(25-10)18-15(19)9-6-12(22-2)14(24-4)13(7-9)23-3/h6-8H,5H2,1-4H3,(H,18,19)(H,20,21) |
| InChIKey | JNFAYUSWFNGZDK-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-ethyl-2-[(3,4,5-trimethoxybenzoyl)amino]thiophene-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-2-[(3,4,5-trimethoxybenzoyl)amino]thiophene-3-carboxylic acid?
The IUPAC name of 5-ethyl-2-[(3,4,5-trimethoxybenzoyl)amino]thiophene-3-carboxylic acid (CID 1082731) is 5-ethyl-2-[(3,4,5-trimethoxybenzoyl)amino]thiophene-3-carboxylic acid.
What is the SMILES notation for 5-ethyl-2-[(3,4,5-trimethoxybenzoyl)amino]thiophene-3-carboxylic acid?
The canonical SMILES for 5-ethyl-2-[(3,4,5-trimethoxybenzoyl)amino]thiophene-3-carboxylic acid is CCc1cc(C(=O)O)c(NC(=O)c2cc(OC)c(OC)c(OC)c2)s1.
What is the InChIKey of 5-ethyl-2-[(3,4,5-trimethoxybenzoyl)amino]thiophene-3-carboxylic acid?
The InChIKey is JNFAYUSWFNGZDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19NO6S/c1-5-10-8-11(17(20)21)16(25-10)18-15(19)9-6-12(22-2)14(24-4)13(7-9)23-3/h6-8H,5H2,1-4H3,(H,18,19)(H,20,21).
What are the key properties of 5-ethyl-2-[(3,4,5-trimethoxybenzoyl)amino]thiophene-3-carboxylic acid?
5-ethyl-2-[(3,4,5-trimethoxybenzoyl)amino]thiophene-3-carboxylic acid has a molecular weight of 365.41 g/mol, XLogP of 3.29, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-2-[(3,4,5-trimethoxybenzoyl)amino]thiophene-3-carboxylic acid is sourced from PubChem (CID 1082731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).