C15H25N3O3 — CID 10827713
1-[(2R,3S)-3-hydroxy-2-piperidin-1-ylhexyl]pyrimidine-2,4-dione (PubChem CID 10827713) has the molecular formula C15H25N3O3 and a molecular weight of 295.38 g/mol. Its IUPAC name is 1-[(2R,3S)-3-hydroxy-2-piperidin-1-ylhexyl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3S)-3-hydroxy-2-piperidin-1-ylhexyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 10827713 |
| Molecular Formula | C15H25N3O3 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | 1-[(2R,3S)-3-hydroxy-2-piperidin-1-ylhexyl]pyrimidine-2,4-dione |
| SMILES | CCC[C@H](O)[C@@H](Cn1ccc(=O)[nH]c1=O)N1CCCCC1 |
| InChI | InChI=1S/C15H25N3O3/c1-2-6-13(19)12(17-8-4-3-5-9-17)11-18-10-7-14(20)16-15(18)21/h7,10,12-13,19H,2-6,8-9,11H2,1H3,(H,16,20,21)/t12-,13+/m1/s1 |
| InChIKey | RVKWLGSSIHNKKN-OLZOCXBDSA-N |
| XLogP | 0.55 |
| TPSA | 78.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |