C18H19NO3 — CID 10827850
trans-ethyl (1S,2S)-2-[(E)-3-(1-methylindol-3-yl)prop-2-enoyl]cyclopropane-1-carboxylate (PubChem CID 10827850) has the molecular formula C18H19NO3 and a molecular weight of 297.35 g/mol. Its IUPAC name is trans-ethyl (1S,2S)-2-[(E)-3-(1-methylindol-3-yl)prop-2-enoyl]cyclopropane-1-carboxylate.
| Compound Name | trans-ethyl (1S,2S)-2-[(E)-3-(1-methylindol-3-yl)prop-2-enoyl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 10827850 |
| Molecular Formula | C18H19NO3 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | trans-ethyl (1S,2S)-2-[(E)-3-(1-methylindol-3-yl)prop-2-enoyl]cyclopropane-1-carboxylate |
| SMILES | CCOC(=O)[C@H]1C[C@@H]1C(=O)/C=C/c1cn(C)c2ccccc12 |
| InChI | InChI=1S/C18H19NO3/c1-3-22-18(21)15-10-14(15)17(20)9-8-12-11-19(2)16-7-5-4-6-13(12)16/h4-9,11,14-15H,3,10H2,1-2H3/b9-8+/t14-,15-/m0/s1 |
| InChIKey | ICUCOOUNBJWACB-JJGIJDNGSA-N |
| XLogP | 2.96 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|