C14H18O7 — CID 10827912
[(1R,2R,6R,8R,9S)-1-acetyloxy-4,4-dimethyl-3,5,7-trioxatricyclo[6.3.0.02,6]undec-10-en-9-yl] acetate (PubChem CID 10827912) has the molecular formula C14H18O7 and a molecular weight of 298.29 g/mol. Its IUPAC name is [(1R,2R,6R,8R,9S)-1-acetyloxy-4,4-dimethyl-3,5,7-trioxatricyclo[6.3.0.02,6]undec-10-en-9-yl] acetate.
| Compound Name | [(1R,2R,6R,8R,9S)-1-acetyloxy-4,4-dimethyl-3,5,7-trioxatricyclo[6.3.0.02,6]undec-10-en-9-yl] acetate |
|---|---|
| PubChem CID | 10827912 |
| Molecular Formula | C14H18O7 |
| Molecular Weight | 298.29 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | [(1R,2R,6R,8R,9S)-1-acetyloxy-4,4-dimethyl-3,5,7-trioxatricyclo[6.3.0.02,6]undec-10-en-9-yl] acetate |
| SMILES | CC(=O)O[C@H]1C=C[C@@]2(OC(C)=O)[C@@H]1O[C@@H]1OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C14H18O7/c1-7(15)17-9-5-6-14(19-8(2)16)10(9)18-12-11(14)20-13(3,4)21-12/h5-6,9-12H,1-4H3/t9-,10+,11-,12+,14+/m0/s1 |
| InChIKey | QZBPRJRHZKKTGV-SVPLCASGSA-N |
| XLogP | 0.67 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.29 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|