About [4-(1,7-dioxaspiro[5.5]undec-4-en-2-yl)-2-hydroxy-2-methylbutyl] acetate
[4-(1,7-dioxaspiro[5.5]undec-4-en-2-yl)-2-hydroxy-2-methylbutyl] acetate (PubChem CID 10827945) has the molecular formula C16H26O5
and a molecular weight of 298.38 g/mol. Its IUPAC name is [4-(1,7-dioxaspiro[5.5]undec-4-en-2-yl)-2-hydroxy-2-methylbutyl] acetate.
Molecular Properties
| Compound Name | [4-(1,7-dioxaspiro[5.5]undec-4-en-2-yl)-2-hydroxy-2-methylbutyl] acetate |
| PubChem CID | 10827945 |
| Molecular Formula | C16H26O5 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | [4-(1,7-dioxaspiro[5.5]undec-4-en-2-yl)-2-hydroxy-2-methylbutyl] acetate |
| SMILES | CC(=O)OCC(C)(O)CCC1CC=CC2(CCCCO2)O1 |
| InChI | InChI=1S/C16H26O5/c1-13(17)19-12-15(2,18)10-7-14-6-5-9-16(21-14)8-3-4-11-20-16/h5,9,14,18H,3-4,6-8,10-12H2,1-2H3 |
| InChIKey | KTYNQTUJBGLVIJ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [4-(1,7-dioxaspiro[5.5]undec-4-en-2-yl)-2-hydroxy-2-methylbutyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(1,7-dioxaspiro[5.5]undec-4-en-2-yl)-2-hydroxy-2-methylbutyl] acetate?
The IUPAC name of [4-(1,7-dioxaspiro[5.5]undec-4-en-2-yl)-2-hydroxy-2-methylbutyl] acetate (CID 10827945) is [4-(1,7-dioxaspiro[5.5]undec-4-en-2-yl)-2-hydroxy-2-methylbutyl] acetate.
What is the SMILES notation for [4-(1,7-dioxaspiro[5.5]undec-4-en-2-yl)-2-hydroxy-2-methylbutyl] acetate?
The canonical SMILES for [4-(1,7-dioxaspiro[5.5]undec-4-en-2-yl)-2-hydroxy-2-methylbutyl] acetate is CC(=O)OCC(C)(O)CCC1CC=CC2(CCCCO2)O1.
What is the InChIKey of [4-(1,7-dioxaspiro[5.5]undec-4-en-2-yl)-2-hydroxy-2-methylbutyl] acetate?
The InChIKey is KTYNQTUJBGLVIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26O5/c1-13(17)19-12-15(2,18)10-7-14-6-5-9-16(21-14)8-3-4-11-20-16/h5,9,14,18H,3-4,6-8,10-12H2,1-2H3.
What are the key properties of [4-(1,7-dioxaspiro[5.5]undec-4-en-2-yl)-2-hydroxy-2-methylbutyl] acetate?
[4-(1,7-dioxaspiro[5.5]undec-4-en-2-yl)-2-hydroxy-2-methylbutyl] acetate has a molecular weight of 298.38 g/mol, XLogP of 2.32, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(1,7-dioxaspiro[5.5]undec-4-en-2-yl)-2-hydroxy-2-methylbutyl] acetate is sourced from PubChem (CID 10827945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).