C19H22FNO — CID 10828013
3-(4-fluorophenyl)-2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-amine (PubChem CID 10828013) has the molecular formula C19H22FNO and a molecular weight of 299.39 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-amine.
| Compound Name | 3-(4-fluorophenyl)-2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-amine |
|---|---|
| PubChem CID | 10828013 |
| Molecular Formula | C19H22FNO |
| Molecular Weight | 299.39 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | 3-(4-fluorophenyl)-2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-amine |
| SMILES | Cc1c(C)c2c(c(C)c1N)C(c1ccc(F)cc1)C(C)(C)O2 |
| InChI | InChI=1S/C19H22FNO/c1-10-11(2)18-15(12(3)17(10)21)16(19(4,5)22-18)13-6-8-14(20)9-7-13/h6-9,16H,21H2,1-5H3 |
| InChIKey | KWPJLBROTXMAIF-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.39 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|