C20H28O2 — CID 10828100
(4aR,11aS)-3-methoxy-4a-phenyl-2,3,4,6,7,8,9,10,11,11a-decahydro-1H-benzo[9]annulen-5-one (PubChem CID 10828100) has the molecular formula C20H28O2 and a molecular weight of 300.44 g/mol. Its IUPAC name is (4aR,11aS)-3-methoxy-4a-phenyl-2,3,4,6,7,8,9,10,11,11a-decahydro-1H-benzo[9]annulen-5-one.
| Compound Name | (4aR,11aS)-3-methoxy-4a-phenyl-2,3,4,6,7,8,9,10,11,11a-decahydro-1H-benzo[9]annulen-5-one |
|---|---|
| PubChem CID | 10828100 |
| Molecular Formula | C20H28O2 |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | (4aR,11aS)-3-methoxy-4a-phenyl-2,3,4,6,7,8,9,10,11,11a-decahydro-1H-benzo[9]annulen-5-one |
| SMILES | COC1CC[C@@H]2CCCCCCC(=O)[C@]2(c2ccccc2)C1 |
| InChI | InChI=1S/C20H28O2/c1-22-18-14-13-17-11-5-2-3-8-12-19(21)20(17,15-18)16-9-6-4-7-10-16/h4,6-7,9-10,17-18H,2-3,5,8,11-15H2,1H3/t17-,18?,20-/m0/s1 |
| InChIKey | DBLQPKOSQQTXKH-DXCJPMOASA-N |
| XLogP | 4.66 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |