About 5,7-difluoro-2-(3-methyl-4-nitrophenyl)-1,3-benzothiazole
5,7-difluoro-2-(3-methyl-4-nitrophenyl)-1,3-benzothiazole (PubChem CID 10828456) has the molecular formula C14H8F2N2O2S
and a molecular weight of 306.29 g/mol. Its IUPAC name is 5,7-difluoro-2-(3-methyl-4-nitrophenyl)-1,3-benzothiazole.
Molecular Properties
| Compound Name | 5,7-difluoro-2-(3-methyl-4-nitrophenyl)-1,3-benzothiazole |
| PubChem CID | 10828456 |
| Molecular Formula | C14H8F2N2O2S |
| Molecular Weight | 306.29 g/mol |
| Exact Mass | 306.03 |
| IUPAC Name | 5,7-difluoro-2-(3-methyl-4-nitrophenyl)-1,3-benzothiazole |
| SMILES | Cc1cc(-c2nc3cc(F)cc(F)c3s2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H8F2N2O2S/c1-7-4-8(2-3-12(7)18(19)20)14-17-11-6-9(15)5-10(16)13(11)21-14/h2-6H,1H3 |
| InChIKey | REYRXLUMUKGKLM-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 56.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.29 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5,7-difluoro-2-(3-methyl-4-nitrophenyl)-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-difluoro-2-(3-methyl-4-nitrophenyl)-1,3-benzothiazole?
The IUPAC name of 5,7-difluoro-2-(3-methyl-4-nitrophenyl)-1,3-benzothiazole (CID 10828456) is 5,7-difluoro-2-(3-methyl-4-nitrophenyl)-1,3-benzothiazole.
What is the SMILES notation for 5,7-difluoro-2-(3-methyl-4-nitrophenyl)-1,3-benzothiazole?
The canonical SMILES for 5,7-difluoro-2-(3-methyl-4-nitrophenyl)-1,3-benzothiazole is Cc1cc(-c2nc3cc(F)cc(F)c3s2)ccc1[N+](=O)[O-].
What is the InChIKey of 5,7-difluoro-2-(3-methyl-4-nitrophenyl)-1,3-benzothiazole?
The InChIKey is REYRXLUMUKGKLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8F2N2O2S/c1-7-4-8(2-3-12(7)18(19)20)14-17-11-6-9(15)5-10(16)13(11)21-14/h2-6H,1H3.
What are the key properties of 5,7-difluoro-2-(3-methyl-4-nitrophenyl)-1,3-benzothiazole?
5,7-difluoro-2-(3-methyl-4-nitrophenyl)-1,3-benzothiazole has a molecular weight of 306.29 g/mol, XLogP of 4.46, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-difluoro-2-(3-methyl-4-nitrophenyl)-1,3-benzothiazole is sourced from PubChem (CID 10828456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).