About methyl 1-[4-(1,2-dimethylimidazol-4-yl)-4-oxobutyl]cyclohexane-1-carboxylate
methyl 1-[4-(1,2-dimethylimidazol-4-yl)-4-oxobutyl]cyclohexane-1-carboxylate (PubChem CID 10828489) has the molecular formula C17H26N2O3
and a molecular weight of 306.41 g/mol. Its IUPAC name is methyl 1-[4-(1,2-dimethylimidazol-4-yl)-4-oxobutyl]cyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | methyl 1-[4-(1,2-dimethylimidazol-4-yl)-4-oxobutyl]cyclohexane-1-carboxylate |
| PubChem CID | 10828489 |
| Molecular Formula | C17H26N2O3 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | methyl 1-[4-(1,2-dimethylimidazol-4-yl)-4-oxobutyl]cyclohexane-1-carboxylate |
| SMILES | COC(=O)C1(CCCC(=O)c2cn(C)c(C)n2)CCCCC1 |
| InChI | InChI=1S/C17H26N2O3/c1-13-18-14(12-19(13)2)15(20)8-7-11-17(16(21)22-3)9-5-4-6-10-17/h12H,4-11H2,1-3H3 |
| InChIKey | JOIRVFSUHUMYQG-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 1-[4-(1,2-dimethylimidazol-4-yl)-4-oxobutyl]cyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-[4-(1,2-dimethylimidazol-4-yl)-4-oxobutyl]cyclohexane-1-carboxylate?
The IUPAC name of methyl 1-[4-(1,2-dimethylimidazol-4-yl)-4-oxobutyl]cyclohexane-1-carboxylate (CID 10828489) is methyl 1-[4-(1,2-dimethylimidazol-4-yl)-4-oxobutyl]cyclohexane-1-carboxylate.
What is the SMILES notation for methyl 1-[4-(1,2-dimethylimidazol-4-yl)-4-oxobutyl]cyclohexane-1-carboxylate?
The canonical SMILES for methyl 1-[4-(1,2-dimethylimidazol-4-yl)-4-oxobutyl]cyclohexane-1-carboxylate is COC(=O)C1(CCCC(=O)c2cn(C)c(C)n2)CCCCC1.
What is the InChIKey of methyl 1-[4-(1,2-dimethylimidazol-4-yl)-4-oxobutyl]cyclohexane-1-carboxylate?
The InChIKey is JOIRVFSUHUMYQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26N2O3/c1-13-18-14(12-19(13)2)15(20)8-7-11-17(16(21)22-3)9-5-4-6-10-17/h12H,4-11H2,1-3H3.
What are the key properties of methyl 1-[4-(1,2-dimethylimidazol-4-yl)-4-oxobutyl]cyclohexane-1-carboxylate?
methyl 1-[4-(1,2-dimethylimidazol-4-yl)-4-oxobutyl]cyclohexane-1-carboxylate has a molecular weight of 306.41 g/mol, XLogP of 3.21, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-[4-(1,2-dimethylimidazol-4-yl)-4-oxobutyl]cyclohexane-1-carboxylate is sourced from PubChem (CID 10828489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).