C18H15NO2S — CID 10828688
3-benzyl-9-methyl-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(12),4,6,8,10-pentaene 2,2-dioxide (PubChem CID 10828688) has the molecular formula C18H15NO2S and a molecular weight of 309.39 g/mol. Its IUPAC name is 3-benzyl-9-methyl-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(12),4,6,8,10-pentaene 2,2-dioxide.
| Compound Name | 3-benzyl-9-methyl-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(12),4,6,8,10-pentaene 2,2-dioxide |
|---|---|
| PubChem CID | 10828688 |
| Molecular Formula | C18H15NO2S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | 3-benzyl-9-methyl-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(12),4,6,8,10-pentaene 2,2-dioxide |
| SMILES | Cc1ccc2c3c(cccc13)N(Cc1ccccc1)S2(=O)=O |
| InChI | InChI=1S/C18H15NO2S/c1-13-10-11-17-18-15(13)8-5-9-16(18)19(22(17,20)21)12-14-6-3-2-4-7-14/h2-11H,12H2,1H3 |
| InChIKey | MOVCXJDWYYWVTP-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |