C17H32O3Si — CID 10828947
(5S)-3-prop-2-enyl-5-[tri(propan-2-yl)silyloxymethyl]oxolan-2-one (PubChem CID 10828947) has the molecular formula C17H32O3Si and a molecular weight of 312.53 g/mol. Its IUPAC name is (5S)-3-prop-2-enyl-5-[tri(propan-2-yl)silyloxymethyl]oxolan-2-one.
| Compound Name | (5S)-3-prop-2-enyl-5-[tri(propan-2-yl)silyloxymethyl]oxolan-2-one |
|---|---|
| PubChem CID | 10828947 |
| Molecular Formula | C17H32O3Si |
| Molecular Weight | 312.53 g/mol |
| Exact Mass | 312.21 |
| IUPAC Name | (5S)-3-prop-2-enyl-5-[tri(propan-2-yl)silyloxymethyl]oxolan-2-one |
| SMILES | C=CCC1C[C@@H](CO[Si](C(C)C)(C(C)C)C(C)C)OC1=O |
| InChI | InChI=1S/C17H32O3Si/c1-8-9-15-10-16(20-17(15)18)11-19-21(12(2)3,13(4)5)14(6)7/h8,12-16H,1,9-11H2,2-7H3/t15?,16-/m0/s1 |
| InChIKey | WCZOAYQWTVNEHV-LYKKTTPLSA-N |
| XLogP | 4.69 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.53 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|