About 5,6-dihexylisoindole-1,3-dione
5,6-dihexylisoindole-1,3-dione (PubChem CID 10829155) has the molecular formula C20H29NO2
and a molecular weight of 315.46 g/mol. Its IUPAC name is 5,6-dihexylisoindole-1,3-dione.
Molecular Properties
| Compound Name | 5,6-dihexylisoindole-1,3-dione |
| PubChem CID | 10829155 |
| Molecular Formula | C20H29NO2 |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.22 |
| IUPAC Name | 5,6-dihexylisoindole-1,3-dione |
| SMILES | CCCCCCc1cc2c(cc1CCCCCC)C(=O)NC2=O |
| InChI | InChI=1S/C20H29NO2/c1-3-5-7-9-11-15-13-17-18(20(23)21-19(17)22)14-16(15)12-10-8-6-4-2/h13-14H,3-12H2,1-2H3,(H,21,22,23) |
| InChIKey | XPTGAMALLXQASQ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 5,6-dihexylisoindole-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dihexylisoindole-1,3-dione?
The IUPAC name of 5,6-dihexylisoindole-1,3-dione (CID 10829155) is 5,6-dihexylisoindole-1,3-dione.
What is the SMILES notation for 5,6-dihexylisoindole-1,3-dione?
The canonical SMILES for 5,6-dihexylisoindole-1,3-dione is CCCCCCc1cc2c(cc1CCCCCC)C(=O)NC2=O.
What is the InChIKey of 5,6-dihexylisoindole-1,3-dione?
The InChIKey is XPTGAMALLXQASQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H29NO2/c1-3-5-7-9-11-15-13-17-18(20(23)21-19(17)22)14-16(15)12-10-8-6-4-2/h13-14H,3-12H2,1-2H3,(H,21,22,23).
What are the key properties of 5,6-dihexylisoindole-1,3-dione?
5,6-dihexylisoindole-1,3-dione has a molecular weight of 315.46 g/mol, XLogP of 4.82, 10 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dihexylisoindole-1,3-dione is sourced from PubChem (CID 10829155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).