C20H28O3 — CID 10829223
(1R,2S,4R,6R,7S,10S)-2,10,13-trimethyl-7-propan-2-yl-3-oxatetracyclo[10.3.0.02,4.06,10]pentadec-12-ene-9,14-dione (PubChem CID 10829223) has the molecular formula C20H28O3 and a molecular weight of 316.44 g/mol. Its IUPAC name is (1R,2S,4R,6R,7S,10S)-2,10,13-trimethyl-7-propan-2-yl-3-oxatetracyclo[10.3.0.02,4.06,10]pentadec-12-ene-9,14-dione.
| Compound Name | (1R,2S,4R,6R,7S,10S)-2,10,13-trimethyl-7-propan-2-yl-3-oxatetracyclo[10.3.0.02,4.06,10]pentadec-12-ene-9,14-dione |
|---|---|
| PubChem CID | 10829223 |
| Molecular Formula | C20H28O3 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | (1R,2S,4R,6R,7S,10S)-2,10,13-trimethyl-7-propan-2-yl-3-oxatetracyclo[10.3.0.02,4.06,10]pentadec-12-ene-9,14-dione |
| SMILES | CC1=C2C[C@]3(C)C(=O)C[C@@H](C(C)C)[C@H]3C[C@H]3O[C@@]3(C)[C@@H]2CC1=O |
| InChI | InChI=1S/C20H28O3/c1-10(2)12-6-17(22)19(4)9-13-11(3)16(21)7-15(13)20(5)18(23-20)8-14(12)19/h10,12,14-15,18H,6-9H2,1-5H3/t12-,14+,15+,18+,19-,20-/m0/s1 |
| InChIKey | HBAXQDCUBUUJCH-DMYWNUKNSA-N |
| XLogP | 3.71 |
| TPSA | 46.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|