C15H24ClNO4 — CID 10829324
(4R,6S)-6-(chloromethyl)-2,2-dimethyl-4-[[(4S,5S)-2,2,5-trimethyl-1,3-dioxolan-4-yl]methyl]-1,3-dioxane-4-carbonitrile (PubChem CID 10829324) has the molecular formula C15H24ClNO4 and a molecular weight of 317.81 g/mol. Its IUPAC name is (4R,6S)-6-(chloromethyl)-2,2-dimethyl-4-[[(4S,5S)-2,2,5-trimethyl-1,3-dioxolan-4-yl]methyl]-1,3-dioxane-4-carbonitrile.
| Compound Name | (4R,6S)-6-(chloromethyl)-2,2-dimethyl-4-[[(4S,5S)-2,2,5-trimethyl-1,3-dioxolan-4-yl]methyl]-1,3-dioxane-4-carbonitrile |
|---|---|
| PubChem CID | 10829324 |
| Molecular Formula | C15H24ClNO4 |
| Molecular Weight | 317.81 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | (4R,6S)-6-(chloromethyl)-2,2-dimethyl-4-[[(4S,5S)-2,2,5-trimethyl-1,3-dioxolan-4-yl]methyl]-1,3-dioxane-4-carbonitrile |
| SMILES | C[C@@H]1OC(C)(C)O[C@H]1C[C@]1(C#N)C[C@@H](CCl)OC(C)(C)O1 |
| InChI | InChI=1S/C15H24ClNO4/c1-10-12(20-13(2,3)18-10)7-15(9-17)6-11(8-16)19-14(4,5)21-15/h10-12H,6-8H2,1-5H3/t10-,11-,12-,15-/m0/s1 |
| InChIKey | JEGVHAXHJNBGRC-ASHKBJFXSA-N |
| XLogP | 2.96 |
| TPSA | 60.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.81 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|