C20H18N2O2 — CID 10829360
2-[(E)-[(1S,4R)-2-bicyclo[2.2.1]heptanylidene]methyl]-3-methylbenzo[f]benzimidazole-4,9-dione (PubChem CID 10829360) has the molecular formula C20H18N2O2 and a molecular weight of 318.38 g/mol. Its IUPAC name is 2-[(E)-[(1S,4R)-2-bicyclo[2.2.1]heptanylidene]methyl]-3-methylbenzo[f]benzimidazole-4,9-dione.
| Compound Name | 2-[(E)-[(1S,4R)-2-bicyclo[2.2.1]heptanylidene]methyl]-3-methylbenzo[f]benzimidazole-4,9-dione |
|---|---|
| PubChem CID | 10829360 |
| Molecular Formula | C20H18N2O2 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | 2-[(E)-[(1S,4R)-2-bicyclo[2.2.1]heptanylidene]methyl]-3-methylbenzo[f]benzimidazole-4,9-dione |
| SMILES | Cn1c(/C=C2\C[C@@H]3CC[C@H]2C3)nc2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C20H18N2O2/c1-22-16(10-13-9-11-6-7-12(13)8-11)21-17-18(22)20(24)15-5-3-2-4-14(15)19(17)23/h2-5,10-12H,6-9H2,1H3/b13-10+/t11-,12+/m1/s1 |
| InChIKey | NOYZQLNJHUCSMA-RSVDQLGHSA-N |
| XLogP | 3.40 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|