C21H34O2 — CID 10829392
(3R,3aS,6S,7R,7aR)-7a-[(2E,4E)-6-methoxy-6-methylhepta-2,4-dien-2-yl]-3,6,7-trimethyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one (PubChem CID 10829392) has the molecular formula C21H34O2 and a molecular weight of 318.50 g/mol. Its IUPAC name is (3R,3aS,6S,7R,7aR)-7a-[(2E,4E)-6-methoxy-6-methylhepta-2,4-dien-2-yl]-3,6,7-trimethyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one.
| Compound Name | (3R,3aS,6S,7R,7aR)-7a-[(2E,4E)-6-methoxy-6-methylhepta-2,4-dien-2-yl]-3,6,7-trimethyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one |
|---|---|
| PubChem CID | 10829392 |
| Molecular Formula | C21H34O2 |
| Molecular Weight | 318.50 g/mol |
| Exact Mass | 318.26 |
| IUPAC Name | (3R,3aS,6S,7R,7aR)-7a-[(2E,4E)-6-methoxy-6-methylhepta-2,4-dien-2-yl]-3,6,7-trimethyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one |
| SMILES | COC(C)(C)/C=C/C=C(\C)[C@@]12CC[C@@H](C)[C@@H]1C(=O)C[C@H](C)[C@H]2C |
| InChI | InChI=1S/C21H34O2/c1-14-10-12-21(16(3)9-8-11-20(5,6)23-7)17(4)15(2)13-18(22)19(14)21/h8-9,11,14-15,17,19H,10,12-13H2,1-7H3/b11-8+,16-9+/t14-,15+,17-,19-,21-/m1/s1 |
| InChIKey | AAWCMLASFGRWPE-MXUVSQIGSA-N |
| XLogP | 5.19 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.50 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|