C17H28O6 — CID 10830132
diethyl 2-[[(4R,6R)-4,6-dimethyl-1,3-dioxan-2-yl]methyl]-2-prop-2-enylpropanedioate (PubChem CID 10830132) has the molecular formula C17H28O6 and a molecular weight of 328.41 g/mol. Its IUPAC name is diethyl 2-[[(4R,6R)-4,6-dimethyl-1,3-dioxan-2-yl]methyl]-2-prop-2-enylpropanedioate.
| Compound Name | diethyl 2-[[(4R,6R)-4,6-dimethyl-1,3-dioxan-2-yl]methyl]-2-prop-2-enylpropanedioate |
|---|---|
| PubChem CID | 10830132 |
| Molecular Formula | C17H28O6 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | diethyl 2-[[(4R,6R)-4,6-dimethyl-1,3-dioxan-2-yl]methyl]-2-prop-2-enylpropanedioate |
| SMILES | C=CCC(CC1O[C@H](C)C[C@@H](C)O1)(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C17H28O6/c1-6-9-17(15(18)20-7-2,16(19)21-8-3)11-14-22-12(4)10-13(5)23-14/h6,12-14H,1,7-11H2,2-5H3/t12-,13-/m1/s1 |
| InChIKey | SHQNXPADPYIWEX-CHWSQXEVSA-N |
| XLogP | 2.61 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|