C23H40O — CID 10830440
(5Z,8Z,11Z,14Z)-1-propan-2-yloxyicosa-5,8,11,14-tetraene (PubChem CID 10830440) has the molecular formula C23H40O and a molecular weight of 332.57 g/mol. Its IUPAC name is (5Z,8Z,11Z,14Z)-1-propan-2-yloxyicosa-5,8,11,14-tetraene.
| Compound Name | (5Z,8Z,11Z,14Z)-1-propan-2-yloxyicosa-5,8,11,14-tetraene |
|---|---|
| PubChem CID | 10830440 |
| Molecular Formula | C23H40O |
| Molecular Weight | 332.57 g/mol |
| Exact Mass | 332.31 |
| IUPAC Name | (5Z,8Z,11Z,14Z)-1-propan-2-yloxyicosa-5,8,11,14-tetraene |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\C/C=C\CCCCOC(C)C |
| InChI | InChI=1S/C23H40O/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-24-23(2)3/h8-9,11-12,14-15,17-18,23H,4-7,10,13,16,19-22H2,1-3H3/b9-8-,12-11-,15-14-,18-17- |
| InChIKey | RBOGOUAWIJCUFT-GKFVBPDJSA-N |
| XLogP | 7.56 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.57 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|