C14H13F3O4S — CID 10830533
ethyl (2E,4E)-5-phenyl-2-(trifluoromethylsulfonyl)penta-2,4-dienoate (PubChem CID 10830533) has the molecular formula C14H13F3O4S and a molecular weight of 334.31 g/mol. Its IUPAC name is ethyl (2E,4E)-5-phenyl-2-(trifluoromethylsulfonyl)penta-2,4-dienoate.
| Compound Name | ethyl (2E,4E)-5-phenyl-2-(trifluoromethylsulfonyl)penta-2,4-dienoate |
|---|---|
| PubChem CID | 10830533 |
| Molecular Formula | C14H13F3O4S |
| Molecular Weight | 334.31 g/mol |
| Exact Mass | 334.05 |
| IUPAC Name | ethyl (2E,4E)-5-phenyl-2-(trifluoromethylsulfonyl)penta-2,4-dienoate |
| SMILES | CCOC(=O)/C(=C\C=C\c1ccccc1)S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C14H13F3O4S/c1-2-21-13(18)12(22(19,20)14(15,16)17)10-6-9-11-7-4-3-5-8-11/h3-10H,2H2,1H3/b9-6+,12-10+ |
| InChIKey | RKJBWBVIUBAPOP-LWGDNYCUSA-N |
| XLogP | 3.08 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.31 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|