C20H40O2Si — CID 10831058
(E,2S,3R,6S)-2,4,6-trimethyl-3-tri(propan-2-yl)silyloxyoct-4-enal (PubChem CID 10831058) has the molecular formula C20H40O2Si and a molecular weight of 340.62 g/mol. Its IUPAC name is (E,2S,3R,6S)-2,4,6-trimethyl-3-tri(propan-2-yl)silyloxyoct-4-enal.
| Compound Name | (E,2S,3R,6S)-2,4,6-trimethyl-3-tri(propan-2-yl)silyloxyoct-4-enal |
|---|---|
| PubChem CID | 10831058 |
| Molecular Formula | C20H40O2Si |
| Molecular Weight | 340.62 g/mol |
| Exact Mass | 340.28 |
| IUPAC Name | (E,2S,3R,6S)-2,4,6-trimethyl-3-tri(propan-2-yl)silyloxyoct-4-enal |
| SMILES | CC[C@H](C)/C=C(\C)[C@H](O[Si](C(C)C)(C(C)C)C(C)C)C(C)C=O |
| InChI | InChI=1S/C20H40O2Si/c1-11-17(8)12-18(9)20(19(10)13-21)22-23(14(2)3,15(4)5)16(6)7/h12-17,19-20H,11H2,1-10H3/b18-12+/t17-,19?,20-/m0/s1 |
| InChIKey | UHMLLUKAGPLCHP-WNPLYWFRSA-N |
| XLogP | 6.37 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.62 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|