C17H34O3Si2 — CID 10831194
ethyl (2E,4Z)-5-[tert-butyl(dimethyl)silyl]-4-(trimethylsilyloxymethyl)penta-2,4-dienoate (PubChem CID 10831194) has the molecular formula C17H34O3Si2 and a molecular weight of 342.63 g/mol. Its IUPAC name is ethyl (2E,4Z)-5-[tert-butyl(dimethyl)silyl]-4-(trimethylsilyloxymethyl)penta-2,4-dienoate.
| Compound Name | ethyl (2E,4Z)-5-[tert-butyl(dimethyl)silyl]-4-(trimethylsilyloxymethyl)penta-2,4-dienoate |
|---|---|
| PubChem CID | 10831194 |
| Molecular Formula | C17H34O3Si2 |
| Molecular Weight | 342.63 g/mol |
| Exact Mass | 342.20 |
| IUPAC Name | ethyl (2E,4Z)-5-[tert-butyl(dimethyl)silyl]-4-(trimethylsilyloxymethyl)penta-2,4-dienoate |
| SMILES | CCOC(=O)/C=C/C(=C/[Si](C)(C)C(C)(C)C)CO[Si](C)(C)C |
| InChI | InChI=1S/C17H34O3Si2/c1-10-19-16(18)12-11-15(13-20-21(5,6)7)14-22(8,9)17(2,3)4/h11-12,14H,10,13H2,1-9H3/b12-11+,15-14- |
| InChIKey | ZIXOEWJRKBDREQ-LTYHPLSISA-N |
| XLogP | 4.93 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.63 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|