C17H18N2O4S — CID 10831437
(1R,2R,6R,7R)-1-ethylsulfanyl-7,8-dimethyl-4-phenyl-10-oxa-4,8-diazatricyclo[5.2.1.02,6]decane-3,5,9-trione (PubChem CID 10831437) has the molecular formula C17H18N2O4S and a molecular weight of 346.41 g/mol. Its IUPAC name is (1R,2R,6R,7R)-1-ethylsulfanyl-7,8-dimethyl-4-phenyl-10-oxa-4,8-diazatricyclo[5.2.1.02,6]decane-3,5,9-trione.
| Compound Name | (1R,2R,6R,7R)-1-ethylsulfanyl-7,8-dimethyl-4-phenyl-10-oxa-4,8-diazatricyclo[5.2.1.02,6]decane-3,5,9-trione |
|---|---|
| PubChem CID | 10831437 |
| Molecular Formula | C17H18N2O4S |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | (1R,2R,6R,7R)-1-ethylsulfanyl-7,8-dimethyl-4-phenyl-10-oxa-4,8-diazatricyclo[5.2.1.02,6]decane-3,5,9-trione |
| SMILES | CCS[C@]12O[C@](C)([C@@H]3C(=O)N(c4ccccc4)C(=O)[C@@H]31)N(C)C2=O |
| InChI | InChI=1S/C17H18N2O4S/c1-4-24-17-12-11(16(2,23-17)18(3)15(17)22)13(20)19(14(12)21)10-8-6-5-7-9-10/h5-9,11-12H,4H2,1-3H3/t11-,12+,16+,17+/m0/s1 |
| InChIKey | HEQASVCEFVKUTO-JQHQGBHXSA-N |
| XLogP | 1.46 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|