C13H21BBr2 — CID 10831547
[(3aR,7aS)-5-tert-butyl-1,2,3,4,7,7a-hexahydroinden-3a-yl]-dibromoborane (PubChem CID 10831547) has the molecular formula C13H21BBr2 and a molecular weight of 347.93 g/mol. Its IUPAC name is [(3aR,7aS)-5-tert-butyl-1,2,3,4,7,7a-hexahydroinden-3a-yl]-dibromoborane.
| Compound Name | [(3aR,7aS)-5-tert-butyl-1,2,3,4,7,7a-hexahydroinden-3a-yl]-dibromoborane |
|---|---|
| PubChem CID | 10831547 |
| Molecular Formula | C13H21BBr2 |
| Molecular Weight | 347.93 g/mol |
| Exact Mass | 346.01 |
| IUPAC Name | [(3aR,7aS)-5-tert-butyl-1,2,3,4,7,7a-hexahydroinden-3a-yl]-dibromoborane |
| SMILES | CC(C)(C)C1=CC[C@@H]2CCC[C@]2(B(Br)Br)C1 |
| InChI | InChI=1S/C13H21BBr2/c1-12(2,3)11-7-6-10-5-4-8-13(10,9-11)14(15)16/h7,10H,4-6,8-9H2,1-3H3/t10-,13-/m0/s1 |
| InChIKey | OEEBCTMWZWWDMR-GWCFXTLKSA-N |
| XLogP | 5.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.93 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|