C21H20N2O3 — CID 10831573
15-[2-(dimethylamino)ethyl]-8-methoxy-15-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,8,10,12-heptaene-14,16-dione (PubChem CID 10831573) has the molecular formula C21H20N2O3 and a molecular weight of 348.40 g/mol. Its IUPAC name is 15-[2-(dimethylamino)ethyl]-8-methoxy-15-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,8,10,12-heptaene-14,16-dione.
| Compound Name | 15-[2-(dimethylamino)ethyl]-8-methoxy-15-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,8,10,12-heptaene-14,16-dione |
|---|---|
| PubChem CID | 10831573 |
| Molecular Formula | C21H20N2O3 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | 15-[2-(dimethylamino)ethyl]-8-methoxy-15-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,8,10,12-heptaene-14,16-dione |
| SMILES | COc1c2ccccc2c2c3c(cccc13)C(=O)N(CCN(C)C)C2=O |
| InChI | InChI=1S/C21H20N2O3/c1-22(2)11-12-23-20(24)16-10-6-9-15-17(16)18(21(23)25)13-7-4-5-8-14(13)19(15)26-3/h4-10H,11-12H2,1-3H3 |
| InChIKey | PDVLBQLZHGQWHF-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|