C14H29NO5SSi — CID 10831780
[(2R,3aR,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazol-2-yl]methyl methanesulfonate (PubChem CID 10831780) has the molecular formula C14H29NO5SSi and a molecular weight of 351.54 g/mol. Its IUPAC name is [(2R,3aR,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazol-2-yl]methyl methanesulfonate.
| Compound Name | [(2R,3aR,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazol-2-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 10831780 |
| Molecular Formula | C14H29NO5SSi |
| Molecular Weight | 351.54 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | [(2R,3aR,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazol-2-yl]methyl methanesulfonate |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CCN2O[C@@H](COS(C)(=O)=O)C[C@H]12 |
| InChI | InChI=1S/C14H29NO5SSi/c1-14(2,3)22(5,6)20-13-7-8-15-12(13)9-11(19-15)10-18-21(4,16)17/h11-13H,7-10H2,1-6H3/t11-,12-,13+/m1/s1 |
| InChIKey | LTSNFKXRVOPZFF-UPJWGTAASA-N |
| XLogP | 2.13 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.54 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|