C21H22O5 — CID 10831969
(1E,4E)-1,5-bis(2,5-dimethoxyphenyl)penta-1,4-dien-3-one (PubChem CID 10831969) has the molecular formula C21H22O5 and a molecular weight of 354.40 g/mol. Its IUPAC name is (1E,4E)-1,5-bis(2,5-dimethoxyphenyl)penta-1,4-dien-3-one.
| Compound Name | (1E,4E)-1,5-bis(2,5-dimethoxyphenyl)penta-1,4-dien-3-one |
|---|---|
| PubChem CID | 10831969 |
| Molecular Formula | C21H22O5 |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | (1E,4E)-1,5-bis(2,5-dimethoxyphenyl)penta-1,4-dien-3-one |
| SMILES | COc1ccc(OC)c(/C=C/C(=O)/C=C/c2cc(OC)ccc2OC)c1 |
| InChI | InChI=1S/C21H22O5/c1-23-18-9-11-20(25-3)15(13-18)5-7-17(22)8-6-16-14-19(24-2)10-12-21(16)26-4/h5-14H,1-4H3/b7-5+,8-6+ |
| InChIKey | SXCNUJCWUYAUNK-KQQUZDAGSA-N |
| XLogP | 4.02 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|