About (5-methoxy-1,2-dimethyl-4,7-dioxoindol-3-yl)methyl 4-fluorobenzoate
(5-methoxy-1,2-dimethyl-4,7-dioxoindol-3-yl)methyl 4-fluorobenzoate (PubChem CID 10832157) has the molecular formula C19H16FNO5
and a molecular weight of 357.34 g/mol. Its IUPAC name is (5-methoxy-1,2-dimethyl-4,7-dioxoindol-3-yl)methyl 4-fluorobenzoate.
Molecular Properties
| Compound Name | (5-methoxy-1,2-dimethyl-4,7-dioxoindol-3-yl)methyl 4-fluorobenzoate |
| PubChem CID | 10832157 |
| Molecular Formula | C19H16FNO5 |
| Molecular Weight | 357.34 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | (5-methoxy-1,2-dimethyl-4,7-dioxoindol-3-yl)methyl 4-fluorobenzoate |
| SMILES | COC1=CC(=O)c2c(c(COC(=O)c3ccc(F)cc3)c(C)n2C)C1=O |
| InChI | InChI=1S/C19H16FNO5/c1-10-13(9-26-19(24)11-4-6-12(20)7-5-11)16-17(21(10)2)14(22)8-15(25-3)18(16)23/h4-8H,9H2,1-3H3 |
| InChIKey | DDGLSHDTSHVXKM-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 74.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.34 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze (5-methoxy-1,2-dimethyl-4,7-dioxoindol-3-yl)methyl 4-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-methoxy-1,2-dimethyl-4,7-dioxoindol-3-yl)methyl 4-fluorobenzoate?
The IUPAC name of (5-methoxy-1,2-dimethyl-4,7-dioxoindol-3-yl)methyl 4-fluorobenzoate (CID 10832157) is (5-methoxy-1,2-dimethyl-4,7-dioxoindol-3-yl)methyl 4-fluorobenzoate.
What is the SMILES notation for (5-methoxy-1,2-dimethyl-4,7-dioxoindol-3-yl)methyl 4-fluorobenzoate?
The canonical SMILES for (5-methoxy-1,2-dimethyl-4,7-dioxoindol-3-yl)methyl 4-fluorobenzoate is COC1=CC(=O)c2c(c(COC(=O)c3ccc(F)cc3)c(C)n2C)C1=O.
What is the InChIKey of (5-methoxy-1,2-dimethyl-4,7-dioxoindol-3-yl)methyl 4-fluorobenzoate?
The InChIKey is DDGLSHDTSHVXKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16FNO5/c1-10-13(9-26-19(24)11-4-6-12(20)7-5-11)16-17(21(10)2)14(22)8-15(25-3)18(16)23/h4-8H,9H2,1-3H3.
What are the key properties of (5-methoxy-1,2-dimethyl-4,7-dioxoindol-3-yl)methyl 4-fluorobenzoate?
(5-methoxy-1,2-dimethyl-4,7-dioxoindol-3-yl)methyl 4-fluorobenzoate has a molecular weight of 357.34 g/mol, XLogP of 2.74, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (5-methoxy-1,2-dimethyl-4,7-dioxoindol-3-yl)methyl 4-fluorobenzoate is sourced from PubChem (CID 10832157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).